Diclofenac sodium
Chemical Structure Depiction of
Diclofenac sodium
Diclofenac sodium
Compound characteristics
| Compound ID: | CE01-9609 |
| Compound Name: | Diclofenac sodium |
| Molecular Weight: | 318.13 |
| Molecular Formula: | C14 H10 Cl2 N O2.Na |
| CAS Number: | 15307-79-6 |
| Smiles: | C(C([O-])=O)c1ccccc1Nc1c(cccc1[Cl])[Cl].[Na+] |
| InChI Key: | KPHWPUGNDIVLNH-UHFFFAOYSA-M |
| Short Description: | Diclofenac sodium (GP 45840) is a non-steroidal anti-inflammatory agent (NSAID) with antipyretic and analgesic actions. It is primarily available as the sodium salt. |
| Pathway: | Immunology/Inflammation|||Apoptosis|||Neuroscience |
| Target: | Apoptosis|||COX |
| Type of molecule: | FDA Approved/Clinical |
| Alias: | GP 45840 |
| Stock amount: | 99679 |