Sonidegib diphosphate
Chemical Structure Depiction of
Sonidegib diphosphate
Sonidegib diphosphate
Compound characteristics
| Compound ID: | CE01-9795 |
| Compound Name: | Sonidegib diphosphate |
| Molecular Weight: | 681.5 |
| Molecular Formula: | C26 H26 F3 N3 O3.H3 O4 P.H3 O4 P |
| CAS Number: | 1218778-77-8 |
| Smiles: | Cc1c(cccc1c1ccc(cc1)OC(F)(F)F)C(Nc1ccc(nc1)N1C[C@H](C)O[C@H](C)C1)=O.OP(O)(O)=O.OP(O)(O)=O |
| InChI Key: | RWIVSVMMGFFZIJ-SZKOKKDDSA-N |
| Short Description: | Sonidegib diphosphate (LDE225 diphosphate) is an effective and selective Smo antagonist (IC50: 1.3 nM and 2.5 nM for mouse and human Smo in a binding assay, respectively). |
| Pathway: | Stem Cells |
| Target: | Smo |
| Type of molecule: | Approved/Clinical |
| Alias: | LDE225 diphosphate , NVP-LDE 225 diphosphate , Erismodegib diphosphate |
| Stock amount: | 686 |