Naproxen sodium
Chemical Structure Depiction of
Naproxen sodium
Naproxen sodium
Compound characteristics
| Compound ID: | CE01-9896 |
| Compound Name: | Naproxen sodium |
| Molecular Weight: | 252.24 |
| Molecular Formula: | C14 H13 O3.Na |
| CAS Number: | 26159-34-2 |
| Smiles: | C[C@H](C([O-])=O)c1ccc2cc(ccc2c1)OC.[Na+] |
| InChI Key: | CDBRNDSHEYLDJV-FVGYRXGTSA-M |
| Short Description: | Naproxen sodium (Anaprox) is a COX inhibitor for COX-1 and COX-2 with analgesic and antipyretic properties. |
| Pathway: | Immunology/Inflammation|||Autophagy|||Neuroscience |
| Target: | COX|||Autophagy |
| Type of molecule: | FDA Approved/Clinical |
| Alias: | Naprelan , Anaprox , RS-3650 , Miranax |
| Stock amount: | 5066 |