N3-PEG4-C2-NHS ester
Chemical Structure Depiction of
N3-PEG4-C2-NHS ester
N3-PEG4-C2-NHS ester
Compound characteristics
| Compound ID: | CE02-0340 |
| Compound Name: | N3-PEG4-C2-NHS ester |
| Molecular Weight: | 388.38 |
| Molecular Formula: | C15 H24 N4 O8 |
| CAS Number: | 944251-24-5 |
| Smiles: | C1CC(N(C1=O)OC(CCOCCOCCOCCOCCN=[N+]=[N-])=O)=O |
| InChI Key: | OIGKWPIMJCPGGD-UHFFFAOYSA-N |
| Short Description: | N3-PEG4-C2-NHS ester is a four-unit polyethylene glycol (PEG) linker that is noncleavable, serving as a crucial component in the synthesis of antibody-drug conjugates (ADCs). |
| Pathway: | Others |
| Target: | Others |
| Stock amount: | 10 |