Omidenepag isopropyl
Chemical Structure Depiction of
Omidenepag isopropyl
Omidenepag isopropyl
Compound characteristics
| Compound ID: | CE02-0470 |
| Compound Name: | Omidenepag isopropyl |
| Molecular Weight: | 520.61 |
| Molecular Formula: | C26 H28 N6 O4 S |
| CAS Number: | 1187451-19-9 |
| Smiles: | CC(C)OC(CNc1cccc(CN(Cc2ccc(cc2)n2cccn2)S(c2cccnc2)(=O)=O)n1)=O |
| InChI Key: | VIQCWEGEHRBLAC-UHFFFAOYSA-N |
| Short Description: | Omidenepag isopropyl is converted to the active product Omidenepag during corneal penetration. Omidenepag isopropyl is a selective EP2 receptor agonist. Omidenepag isopropyl displays only a weak affin ity for EP1, EP2, and FP receptors. Omidenepag isopropyl is under development for the treatment of glaucoma as intraocular pressure (IOP)-lowering drug. |
| Pathway: | GPCR/G Protein|||Immunology/Inflammation |
| Target: | Prostaglandin Receptor |
| Stock amount: | 100 |