(S,R,S)-AHPC-amido-C5-acid
Chemical Structure Depiction of
(S,R,S)-AHPC-amido-C5-acid
(S,R,S)-AHPC-amido-C5-acid
Compound characteristics
| Compound ID: | CE02-2774 |
| Compound Name: | (S,R,S)-AHPC-amido-C5-acid |
| Molecular Weight: | 572.72 |
| Molecular Formula: | C29 H40 N4 O6 S |
| CAS Number: | 2162120-87-6 |
| Smiles: | Cc1c(c2ccc(CNC([C@@H]3C[C@H](CN3C([C@H](C(C)(C)C)NC(CCCCCC(O)=O)=O)=O)O)=O)cc2)scn1 |
| InChI Key: | LYAMSRXTXVKKIC-AOJNWGRGSA-N |
| Short Description: | (S,R,S)-AHPC-amido-C5-acid is a chemical compound that contains a VHL ligand for the E3 ubiquitin ligase and a PROTAC linker. It can be utilized in the design of XY028-133[1]. |
| Pathway: | Others |
| Target: | Others |
| Stock amount: | 2 |