3,6-Dichlorotrimellitic anhydride
Chemical Structure Depiction of
3,6-Dichlorotrimellitic anhydride
3,6-Dichlorotrimellitic anhydride
Compound characteristics
| Compound ID: | CE02-3007 |
| Compound Name: | 3,6-Dichlorotrimellitic anhydride |
| Molecular Weight: | 261.01 |
| Molecular Formula: | C9 H2 Cl2 O5 |
| CAS Number: | 81742-10-1 |
| Smiles: | c1c(C(O)=O)c(c2C(=O)OC(c2c1[Cl])=O)[Cl] |
| InChI Key: | OCUQMPDZMXSVFG-UHFFFAOYSA-N |
| Short Description: | 3,6-Dichlorotrimellitic anhydride serves as the essential precursor in the synthesis of various dichlorinated fluoresceins and rhodamines. |
| Pathway: | Others |
| Target: | Others |
| Stock amount: | 987 |