BAY 11-7082
Chemical Structure Depiction of
BAY 11-7082
BAY 11-7082
Compound characteristics
| Compound ID: | CE02-3145 |
| Compound Name: | BAY 11-7082 |
| Molecular Weight: | 207.25 |
| Molecular Formula: | C10 H9 N O2 S |
| CAS Number: | 19542-67-7 |
| Smiles: | Cc1ccc(cc1)S(/C=C/C#N)(=O)=O |
| InChI Key: | DOEWDSDBFRHVAP-UHFFFAOYSA-N |
| Short Description: | BAY 11-7082 (BAY 11-7821) is an NF-kappaB inhibitor that inhibits TNFalpha-induced IkappaBalpha phosphorylation (IC50=10 muM). BAY 11-7082 is also an inhibitor of the ubiquitin-specific proteases USP7 and USP21 (IC50=0.19/0.96 muM). |
| Pathway: | Ubiquitination|||Autophagy|||NF-Kappab|||DNA Damage/DNA Repair|||Others|||Cell Cycle/Checkpoint|||Apoptosis |
| Target: | IkappaB/IKK|||DUB|||Others|||Apoptosis|||Autophagy |
| Alias: | BAY 11-7821 |
| Stock amount: | 1069 |