MCLA hydrochloride
Chemical Structure Depiction of
MCLA hydrochloride
MCLA hydrochloride
Compound characteristics
| Compound ID: | CE02-3149 |
| Compound Name: | MCLA hydrochloride |
| Molecular Weight: | 291.73 |
| Molecular Formula: | C14 H13 N3 O2.H Cl |
| CAS Number: | 128322-44-1 |
| Smiles: | CC1C(N2C=C(c3ccc(cc3)OC)NC=C2N=1)=O.[Cl] |
| InChI Key: | KGMPQNFFCUDXSO-UHFFFAOYSA-N |
| Short Description: | MCLA hydrochloride, a chemiluminescent compound, can be used to quantify aqueous concentrations of superoxide. |
| Pathway: | Others |
| Target: | Others |
| Stock amount: | 100 |