(R)-(-)-JQ1 Enantiomer
Chemical Structure Depiction of
(R)-(-)-JQ1 Enantiomer
(R)-(-)-JQ1 Enantiomer
Compound characteristics
| Compound ID: | CE02-3711 |
| Compound Name: | (R)-(-)-JQ1 Enantiomer |
| Molecular Weight: | 456.99 |
| Molecular Formula: | C23 H25 Cl N4 O2 S |
| CAS Number: | 1268524-71-5 |
| Smiles: | Cc1c2C(c3ccc(cc3)[Cl])=N[C@H](CC(=O)OC(C)(C)C)c3nnc(C)n3c2sc1C |
| InChI Key: | DNVXATUJJDPFDM-QGZVFWFLSA-N |
| Short Description: | (R)-(-)-JQ1 Enantiomer is the stereoisomer of (+)-JQ1. (+)-JQ1 is a BET bromodomain inhibitor, acting on BRD4(1/2)(IC50 of 77 nM/33 nM in a cell-free assay) |
| Pathway: | Chromatin/Epigenetic |
| Target: | Epigenetic Reader Domain |
| Stock amount: | 874 |