A 77-01
Chemical Structure Depiction of
A 77-01
A 77-01
Compound characteristics
| Compound ID: | CE02-5009 |
| Compound Name: | A 77-01 |
| Molecular Weight: | 286.33 |
| Molecular Formula: | C18 H14 N4 |
| CAS Number: | 607737-87-1 |
| Smiles: | Cc1cccc(c2c(c[nH]n2)c2ccnc3ccccc23)n1 |
| InChI Key: | KJTYZDORHCDZPS-UHFFFAOYSA-N |
| Short Description: | A 77-01 is a potent inhibitor of TGF-(beta) type I receptor superfamily activin-like kinase ALK5 with IC50 of 25 nM. |
| Pathway: | Stem Cells|||Angiogenesis|||Tyrosine Kinase/Adaptors |
| Target: | ALK|||TGF-beta/Smad |
| Alias: | A77-01 |
| Stock amount: | 846 |