BRL 52537 hydrochloride
Chemical Structure Depiction of
BRL 52537 hydrochloride
BRL 52537 hydrochloride
Compound characteristics
| Compound ID: | CE02-5679 |
| Compound Name: | BRL 52537 hydrochloride |
| Molecular Weight: | 391.77 |
| Molecular Formula: | C18 H24 Cl2 N2 O.H Cl |
| CAS Number: | 112282-24-3 |
| Smiles: | C1CCN(C(C1)CN1CCCC1)C(Cc1ccc(c(c1)[Cl])[Cl])=O.[Cl] |
| InChI Key: | NGVLSOWJSUUYDE-XFULWGLBSA-N |
| Short Description: | BRL 52537 hydrochloride is a selective and specific KOR agonist which has been implicated in neuroprotection from ischemic neuronal injury[1]. It is used for research into potential treatments for str oke and heart attack as well as more general brain research. |
| Pathway: | Neuroscience|||Endocrinology/Hormones|||GPCR/G Protein |
| Target: | Opioid Receptor |
| Stock amount: | 221 |