BMS 753
Chemical Structure Depiction of
BMS 753
BMS 753
Compound characteristics
| Compound ID: | CE02-5860 |
| Compound Name: | BMS 753 |
| Molecular Weight: | 351.4 |
| Molecular Formula: | C21 H21 N O4 |
| CAS Number: | 215307-86-1 |
| Smiles: | CC1(C)C(C(C)(C)c2cc(ccc12)C(Nc1ccc(cc1)C(O)=O)=O)=O |
| InChI Key: | KFBPBWUZXBYJDG-UHFFFAOYSA-N |
| Short Description: | BMS 753 is an agonist of isotype-selective retinoic acid receptor alpha (RARalpha, Ki= 2 nM). |
| Pathway: | Metabolism |
| Target: | Retinoid Receptor |
| Stock amount: | 984 |