Aminopurvalanol A
Chemical Structure Depiction of
Aminopurvalanol A
Aminopurvalanol A
Compound characteristics
| Compound ID: | CE02-5974 |
| Compound Name: | Aminopurvalanol A |
| Molecular Weight: | 403.91 |
| Molecular Formula: | C19 H26 Cl N7 O |
| CAS Number: | 220792-57-4 |
| Smiles: | CC(C)[C@H](CO)Nc1nc(c2c(n1)n(cn2)C(C)C)Nc1cc(cc(c1)[Cl])N |
| InChI Key: | RAMROQQYRRQPDL-HNNXBMFYSA-N |
| Short Description: | Aminopurvalanol A is a competitive, selective and cell-permeable inhibitor of cyclin-dependent kinase (CDK) that potently inhibits Cyclin A/cdk2, Cyclin B/cdk1, Cyclin E/cdk2, and P35/cdk5 with IC50 o f 33 nM, 33 nM, 28 nM and 20 nM, respectively. |
| Pathway: | Cell Cycle/Checkpoint |
| Target: | CDK |
| Stock amount: | 5966 |