UNC 669
Chemical Structure Depiction of
UNC 669
UNC 669
Compound characteristics
| Compound ID: | CE02-6231 |
| Compound Name: | UNC 669 |
| Molecular Weight: | 338.25 |
| Molecular Formula: | C15 H20 Br N3 O |
| CAS Number: | 1314241-44-5 |
| Smiles: | C1CCN(C1)C1CCN(CC1)C(c1cc(cnc1)[Br])=O |
| InChI Key: | CQERVFFAOOUFEQ-UHFFFAOYSA-N |
| Short Description: | UNC 669 is an effective and specific MBT (malignant brain tumor) inhibitor with IC50 of 4.2/3.1 uM for L3MBTL1/3. |
| Pathway: | Chromatin/Epigenetic |
| Target: | Epigenetic Reader Domain |
| Alias: | UNC669 |
| Stock amount: | 916 |