Pyrromecaine HCl
Chemical Structure Depiction of
Pyrromecaine HCl
Pyrromecaine HCl
Compound characteristics
| Compound ID: | CE02-8509 |
| Compound Name: | Pyrromecaine HCl |
| Molecular Weight: | 324.89 |
| Molecular Formula: | C18 H28 N2 O.H Cl |
| CAS Number: | 19089-24-8 |
| Smiles: | CCCCN1CCCC1C(Nc1c(C)cc(C)cc1C)=O.[Cl] |
| InChI Key: | NFEZGTHMTGKIBG-NTISSMGPSA-N |
| Short Description: | Pyrromecaine is a local anesthetic used for surface anesthesia. Pyromecaine has a wide spectrum of antiarrhythmic action, exerts a favorable effect on the contractility of the left ventricle, and on t he myocardial blood flow following the ligation of the coronary artery. |
| Alias: | Bumecaine hydrochloride , Pyrromecaine |
| Stock amount: | 100 |