Advantame anhydrous
Chemical Structure Depiction of
Advantame anhydrous
Advantame anhydrous
Compound characteristics
| Compound ID: | CE02-8842 |
| Compound Name: | Advantame anhydrous |
| Molecular Weight: | 458.51 |
| Molecular Formula: | C24 H30 N2 O7 |
| CAS Number: | 245650-17-3 |
| Smiles: | COC([C@H](Cc1ccccc1)NC([C@H](CC(O)=O)NCCCc1ccc(c(c1)O)OC)=O)=O |
| InChI Key: | YTKBWWKAVMSYHE-OALUTQOASA-N |
| Short Description: | Advantame anhydrous is a non-caloric sweetener, synthesized from isovanillin and aspartame. The U.S. Food and Drug Administration has approved Advantame for general use in foods and beverages except f or meat and poultry as a food additive. |
| Alias: | Advantame |
| Stock amount: | 100 |