Bakkenolide A
Chemical Structure Depiction of
Bakkenolide A
Bakkenolide A
Compound characteristics
| Compound ID: | CE03-4173 |
| Compound Name: | Bakkenolide A |
| Molecular Weight: | 234.34 |
| Molecular Formula: | C15 H22 O2 |
| CAS Number: | 19906-72-0 |
| Smiles: | [H][C@@]12CCC[C@H](C)[C@@]2(C)C[C@]2(C1)C(=C)COC2=O |
| InChI Key: | OVXAYHNZXBOVPV-OBCWZRDOSA-N |
| Short Description: | Bakkenolide A has antifeedant and growth inhibitory effects on neonate variegated cutworms, it inhibits leukemia by regulation of HDAC3 and PI3K/Akt-related signaling pathways. |
| Pathway: | DNA Damage/DNA Repair|||Apoptosis|||Cytoskeletal Signaling|||NF-Kappab|||Proteases/Proteasome|||Stem Cells|||Chromatin/Epigenetic|||Immunology/Inflammation|||PI3K/Akt/mTOR signaling |
| Target: | Akt|||HDAC|||GSK-3|||IL Receptor|||Caspase|||PI3K|||IkappaB/IKK|||TNF |
| Stock amount: | 2 |