BMS 180448
Chemical Structure Depiction of
BMS 180448
BMS 180448
Compound characteristics
| Compound ID: | CE03-4771 |
| Compound Name: | BMS 180448 |
| Molecular Weight: | 395.85 |
| Molecular Formula: | C20 H18 Cl N5 O2 |
| CAS Number: | 144264-47-1 |
| Smiles: | CC1(C)[C@@H]([C@H](c2cc(C#N)ccc2O1)/N=C(NC#N)/Nc1ccc(cc1)[Cl])O |
| InChI Key: | VLICJSLDCJXZBG-ZWKOTPCHSA-N |
| Short Description: | BMS 180448 is a prototype mitochondrial ATP-sensitive K+ (Mitok (ATP)) channel opener with cardioprotective and vasodilating properties. |
| Alias: | BMS180448 , BMS-180448 |
| Stock amount: | 100 |