(Z)-SMI-4a
Chemical Structure Depiction of
(Z)-SMI-4a
(Z)-SMI-4a
Compound characteristics
| Compound ID: | CE03-4871 |
| Compound Name: | (Z)-SMI-4a |
| Molecular Weight: | 273.23 |
| Molecular Formula: | C11 H6 F3 N O2 S |
| CAS Number: | 438190-29-5 |
| Smiles: | C(=C1/C(NC(=O)S1)=O)\c1cccc(c1)C(F)(F)F |
| InChI Key: | NGJLOFCOEOHFKQ-UHFFFAOYSA-N |
| Short Description: | (Z)-SMI-4a (TCS PIM-1 4a) is a selective ATP-competitive Pim-1 kinase inhibitor with an IC50 of 21 nM. |
| Pathway: | JAK/STAT signaling|||Chromatin/Epigenetic |
| Target: | Pim |
| Type of molecule: | Preclinical |
| Alias: | TCS PIM-1 4a , SMI-4a |
| Stock amount: | 1261 |