CHIR 98024
Chemical Structure Depiction of
CHIR 98024
CHIR 98024
Compound characteristics
| Compound ID: | CE03-5033 |
| Compound Name: | CHIR 98024 |
| Molecular Weight: | 486.32 |
| Molecular Formula: | C20 H17 Cl2 N9 O2 |
| CAS Number: | 556813-39-9 |
| Smiles: | C(CNc1ncc(c(c2ccc(cc2[Cl])[Cl])n1)c1ncc[nH]1)Nc1ccc(c(N)n1)[N+]([O-])=O |
| InChI Key: | NDFXSHIIGXVOKT-UHFFFAOYSA-N |
| Short Description: | CHIR 98024 is a potent GSK-3alpha/beta inhibitor with IC50 of 0.65 nM/0.58 nM in cell-free assays, with the ability to distinguish GSK-3 from its closest homologs Cdc2 and ERK2. |
| Pathway: | Stem Cells|||MAPK|||PI3K/Akt/mTOR signaling |
| Target: | GSK-3|||S6 Kinase |
| Alias: | CHIR98014 |
| Stock amount: | 484 |