Ganodermic acid S
Chemical Structure Depiction of
Ganodermic acid S
Ganodermic acid S
Compound characteristics
| Compound ID: | CE03-6229 |
| Compound Name: | Ganodermic acid S |
| Molecular Weight: | 554.77 |
| Molecular Formula: | C34 H50 O6 |
| CAS Number: | 112430-63-4 |
| Smiles: | [H][C@]12CC=C3C(=CC[C@@]4(C)[C@@]3(C)[C@H](C[C@]4([H])[C@H](C)CC\C=C(/C)C(O)=O)OC(C)=O)[C@@]2(C)CC[C@@H](C1(C)C)OC(C)=O |
| InChI Key: | OTUZGGSAOMCYNC-QFCWAIIRSA-N |
| Short Description: | Ganodermic acid S, as a membrane acting agent isolated from the fungus Ganoderma lucidum, exerts multiple effects on human platelet function. |
| Alias: | Ganoderic acid R |
| Stock amount: | 25 |