RO 46-8443
Chemical Structure Depiction of
RO 46-8443
RO 46-8443
Compound characteristics
| Compound ID: | CE03-9117 |
| Compound Name: | RO 46-8443 |
| Molecular Weight: | 609.7 |
| Molecular Formula: | C31 H35 N3 O8 S |
| CAS Number: | 175556-12-4 |
| Smiles: | CC(C)(C)c1ccc(cc1)S(Nc1c(c(nc(c2ccc(cc2)OC)n1)OC[C@@H](CO)O)Oc1ccccc1OC)(=O)=O |
| InChI Key: | DRIHNVYRUGBDHI-JOCHJYFZSA-N |
| Short Description: | RO 46-8443 is the first non-peptide endothelin ETB receptor selective antagonist. RO 46-8443 displays up to 2000-fold selectivity for ETB receptors both in terms of binding inhibitory potency and func tional inhibition. |
| Pathway: | GPCR/G Protein |
| Target: | Endothelin Receptor |
| Stock amount: | 988 |