NSC 15364
Chemical Structure Depiction of
NSC 15364
NSC 15364
Compound characteristics
| Compound ID: | CE04-0066 |
| Compound Name: | NSC 15364 |
| Molecular Weight: | 242.28 |
| Molecular Formula: | C13 H14 N4 O |
| CAS Number: | 4550-72-5 |
| Smiles: | c1cc(ccc1N)NC(Nc1ccc(cc1)N)=O |
| InChI Key: | MAPWYRGGJSHAAU-UHFFFAOYSA-N |
| Short Description: | NSC 15364 (1,3-Bis(4-aminophenyl)urea) can be used for screening of ALR inhibitors by detection of hydrogen peroxide production Measured in Biochemical System. |
| Pathway: | Others|||Apoptosis|||Membrane transporter/Ion channel |
| Target: | Others|||Apoptosis|||VDAC |
| Alias: | NSC15364 , 1,3-Bis(4-aminophenyl)urea |
| Stock amount: | 990 |