6beta-Prostaglandin I1
Chemical Structure Depiction of
6beta-Prostaglandin I1
6beta-Prostaglandin I1
Compound characteristics
| Compound ID: | CE04-0562 |
| Compound Name: | 6beta-Prostaglandin I1 |
| Molecular Weight: | 354.49 |
| Molecular Formula: | C20 H34 O5 |
| CAS Number: | 62770-50-7 |
| Smiles: | [H][C@]12C[C@H]([C@H](/C=C/[C@H](CCCCC)O)[C@@]1([H])C[C@H](CCCCC(O)=O)O2)O |
| InChI Key: | RJADQDXZYFCVHV-KOUJMVCDSA-N |
| Short Description: | 6beta-PGI1 is a stable PGI2 analog resistant to hydrolysis in aqueous solutions. 6beta-PGI1 has a much longer half-life than PGI2, but a greatly reduced molar potency for receptor mediated function. 6 beta-PGI1 has a Kact for adenylate cyclase in NCB-20 cells of 4.2 muM compared with 18 nM for PGI2. The potency for vasodilation and inhibition of platelet aggregation is about 1% of PGI2. |
| Alias: | 6beta-Prostaglandin I1 |
| Stock amount: | 10 |