Relugolix
Chemical Structure Depiction of
Relugolix
Relugolix
Compound characteristics
| Compound ID: | CE04-0604 |
| Compound Name: | Relugolix |
| Molecular Weight: | 623.64 |
| Molecular Formula: | C29 H27 F2 N7 O5 S |
| CAS Number: | 737789-87-6 |
| Smiles: | CN(C)Cc1c2C(N(C(N(Cc3c(cccc3F)F)c2sc1c1ccc(cc1)NC(NOC)=O)=O)c1ccc(nn1)OC)=O |
| InChI Key: | AOMXMOCNKJTRQP-UHFFFAOYSA-N |
| Short Description: | Relugolix (RVT-601) is an orally available, non-peptide gonadotropin-releasing hormone (GnRH or luteinizing hormone-releasing hormone (LHRH)) antagonist, with potential antineoplastic activity. Relugo lix competitively binds to and blocks the GnRH receptor in the anterior pituitary gland, which both prevents GnRH binding to the GnRH receptor and inhibits the secretion and release of both luteinizin g hormone (LH) and follicle stimulating hormone (FSH). In males, the inhibition of LH secretion prevents the release of testosterone from Leydig cells in the testes. Since testosterone is required to sustain prostate growth, reducing testosterone levels may inhibit hormone-dependent prostate cancer cell proliferation. |
| Pathway: | GPCR/G Protein |
| Target: | GNRH Receptor |
| Type of molecule: | FDA Approved/Clinical |
| Alias: | RVT-601 , TAK-385 |
| Stock amount: | 1227 |