Dehydro Nifedipine
Chemical Structure Depiction of
Dehydro Nifedipine
Dehydro Nifedipine
Compound characteristics
| Compound ID: | CE04-0920 |
| Compound Name: | Dehydro Nifedipine |
| Molecular Weight: | 344.32 |
| Molecular Formula: | C17 H16 N2 O6 |
| CAS Number: | 67035-22-7 |
| Smiles: | Cc1c(C(=O)OC)c(c2ccccc2[N+]([O-])=O)c(C(=O)OC)c(C)n1 |
| InChI Key: | UMQHJQGNGLQJPF-UHFFFAOYSA-N |
| Short Description: | Dehydro Nifedipine (BAY-b 4759) is the main metabolite of nifedipine in human plasma. Dehydro Nifedipine inhibits glucose uptake in PC-12 cells with an IC50 value of 130 muM. Nifedipine is a calcium c hannel blocker used in the treatment of hypertension and angina. Dehydronifedipine is formed when it is metabolized by cytochrome P450 (CYP) isomers CYP3A4 and CYP3A5. |
| Alias: | BAY-b 4759 |
| Stock amount: | 989 |