5-hydroxy-6-methoxy (S)-Duloxetine
Chemical Structure Depiction of
5-hydroxy-6-methoxy (S)-Duloxetine
5-hydroxy-6-methoxy (S)-Duloxetine
Compound characteristics
| Compound ID: | CE04-1406 |
| Compound Name: | 5-hydroxy-6-methoxy (S)-Duloxetine |
| Molecular Weight: | 343.44 |
| Molecular Formula: | C19 H21 N O3 S |
| CAS Number: | 741693-79-8 |
| Smiles: | CNCC[C@@H](c1cccs1)Oc1cccc2c(c(ccc12)OC)O |
| InChI Key: | MHWRJCBZOCBFBD-INIZCTEOSA-N |
| Short Description: | 5-hydroxy-6-methoxy (S)-Duloxetine is a metabolite of (S)-duloxetine . It is formed from (S)-duloxetine via a 5- or 6-hydroxy duloxetine intermediate, which is formed by the cytochrome P450 (CYP) isof orms CYP1A2 and CYP2D6, and a catechol duloxetine intermediate. 5-hydroxy-6-methoxy (S)-Duloxetine binds to the serotonin (5-HT), norepinephrine, and dopamine transporters with Ki values of 266, 920, and 2,814 nM, respectively. |
| Stock amount: | 1 |