5(S)-HETE lactone
Chemical Structure Depiction of
5(S)-HETE lactone
5(S)-HETE lactone
Compound characteristics
| Compound ID: | CE04-1808 |
| Compound Name: | 5(S)-HETE lactone |
| Molecular Weight: | 302.46 |
| Molecular Formula: | C20 H30 O2 |
| CAS Number: | 127708-42-3 |
| Smiles: | CCCCC\C=C/C\C=C/C\C=C/C=C/[C@@H]1CCCC(=O)O1 |
| InChI Key: | QZMAEYDIHWEEAF-MSFIICATSA-N |
| Short Description: | 5(S)-HETE lactone is a cyclic ester formed by acid-catalyzed nucleophilic addition of the C-5 hydroxyl to the C-1 carboxyl of 5(S)-HETE. The ability of (+-)5-HETE lactone to inhibit rat basophilic leu kemia cell 5-lipoxygenase (IC50 = 27 muM) may be entirely due to the 5(S) isomer, but the enantiomers have not been tested separately. |
| Stock amount: | 100 |