Iromycin A
Chemical Structure Depiction of
Iromycin A
Iromycin A
Compound characteristics
| Compound ID: | CE04-2328 |
| Compound Name: | Iromycin A |
| Molecular Weight: | 303.44 |
| Molecular Formula: | C19 H29 N O2 |
| CAS Number: | 213137-53-2 |
| Smiles: | CCCC1=C(C\C=C(/C)C/C=C/C(C)C)NC(C(C)=C1O)=O |
| InChI Key: | HVAVEUHAOCVIPN-UHFFFAOYSA-N |
| Short Description: | Iromycin A is a bacterial pyridone metabolite that inhibits nitric oxide synthase (NOS) activity, with selectivity for NOS III (endothelial NOS) over NOS I (neuronal NOS). Iromycin metabolites and der ivatives block NADH oxidation in beef heart submitochondrial particles (IC50 = 0.461 muM for iromycin A). |
| Stock amount: | 5 |