Xanomeline tartrate
Chemical Structure Depiction of
Xanomeline tartrate
Xanomeline tartrate
Compound characteristics
| Compound ID: | CE04-3068 |
| Compound Name: | Xanomeline tartrate |
| Molecular Weight: | 431.51 |
| Molecular Formula: | C14 H23 N3 O S.C4 H6 O6 |
| CAS Number: | 152854-19-8 |
| Smiles: | CCCCCCOc1c(C2CN(C)CCC=2)nsn1.C([C@@H]([C@H](C(O)=O)O)O)(O)=O |
| InChI Key: | SJSVWTMVMBGIHQ-LREBCSMRSA-N |
| Short Description: | Xanomeline (LY 246708), a potent agonist of muscarinic M1/M4 receptors, exhibits antipsychotic-like activity and enhances neuronal excitability. It is a valuable compound for studying schizophrenia. |
| Alias: | LY 246708 tartrate , Xanomeline tartrate |
| Stock amount: | 2 |