Melflufen hydrochloride
Chemical Structure Depiction of
Melflufen hydrochloride
Melflufen hydrochloride
Compound characteristics
| Compound ID: | CE04-4507 |
| Compound Name: | Melflufen hydrochloride |
| Molecular Weight: | 534.89 |
| Molecular Formula: | C24 H30 Cl2 F N3 O3.H Cl |
| CAS Number: | 380449-54-7 |
| Smiles: | CCOC([C@H](Cc1ccc(cc1)F)NC([C@H](Cc1ccc(cc1)N(CC[Cl])CC[Cl])N)=O)=O.[Cl] |
| InChI Key: | ZCMWSKHHXLCVHI-VROPFNGYSA-N |
| Short Description: | Melflufen (Melphalan flufenamide) hydrochloride, an alkylating agent and dipeptide prodrug of Melphalan, exhibits antitumor activity by inducing irreversible DNA damage and cytotoxicity in multiple my eloma (MM) cells, while also inhibiting angiogenesis. |
| Alias: | Melflufen hydrochloride , Melphalan flufenamide hydrochloride |
| Stock amount: | 5 |