TAK-659 hydrochloride
Chemical Structure Depiction of
TAK-659 hydrochloride
TAK-659 hydrochloride
Compound characteristics
| Compound ID: | CE04-5277 |
| Compound Name: | TAK-659 hydrochloride |
| Molecular Weight: | 380.85 |
| Molecular Formula: | C17 H21 F N6 O.H Cl |
| CAS Number: | 1952251-28-3 |
| Smiles: | Cn1cc(cn1)c1c2C(NCc2c(c(N[C@@H]2CCCC[C@@H]2N)n1)F)=O.[Cl] |
| InChI Key: | PTCFBXMEFRIEGV-ZVWHLABXSA-N |
| Short Description: | TAK-659 hydrochloride (TAK-659) is a potent and selective inhibitor of spleen tyrosine kinase (SYK) with an IC50 value of 3.2 nM. It is selective against most other kinases, but potent toward both SYK and FLT3. |
| Pathway: | Chromatin/Epigenetic|||Stem Cells|||JAK/STAT signaling|||Angiogenesis|||Tyrosine Kinase/Adaptors |
| Target: | Syk|||FLT|||JAK|||VEGFR|||Tyrosine Kinases |
| Type of molecule: | Clinical/Preclinical |
| Alias: | TAK-659 |
| Stock amount: | 972 |