BAY 61-3606
Chemical Structure Depiction of
BAY 61-3606
BAY 61-3606
Compound characteristics
| Compound ID: | CE04-5330 |
| Compound Name: | BAY 61-3606 |
| Molecular Weight: | 390.4 |
| Molecular Formula: | C20 H18 N6 O3 |
| CAS Number: | 732983-37-8 |
| Smiles: | COc1ccc(cc1OC)c1cc2nccn2c(Nc2c(cccn2)C(N)=O)n1 |
| InChI Key: | JWQOJVOKBAAAAR-UHFFFAOYSA-N |
| Short Description: | BAY 61-3606 (Syk inhibitor IV) is a potent, ATP-competitive, reversible, and highly selective inhibitor of Syk tyrosine kinase activity (Ki= 7.5 nM), exhibiting no inhibitory effect against Btk, Fyn, Itk, Lyn, and Src. |
| Pathway: | Angiogenesis|||Apoptosis|||Tyrosine Kinase/Adaptors |
| Target: | Apoptosis|||Syk |
| Alias: | Syk inhibitor IV |
| Stock amount: | 148 |