Diroximel fumarate
Chemical Structure Depiction of
Diroximel fumarate
Diroximel fumarate
Compound characteristics
| Compound ID: | CE04-5338 |
| Compound Name: | Diroximel fumarate |
| Molecular Weight: | 255.22 |
| Molecular Formula: | C11 H13 N O6 |
| CAS Number: | 1577222-14-0 |
| Smiles: | COC(/C=C/C(=O)OCCN1C(CCC1=O)=O)=O |
| InChI Key: | YIMYDTCOUQIDMT-UHFFFAOYSA-N |
| Short Description: | Diroximel fumarate (Diroximel Fumarete), a prodrug of monomethyl fumarate in a controlled-release formulation, rapidly and potently converts to MMF in the body. |
| Pathway: | Others |
| Target: | Others |
| Type of molecule: | FDA Approved/Clinical |
| Alias: | Diroximel Fumarete |
| Stock amount: | 1297 |