NS 11021
Chemical Structure Depiction of
NS 11021
NS 11021
Compound characteristics
| Compound ID: | CE04-5362 |
| Compound Name: | NS 11021 |
| Molecular Weight: | 511.24 |
| Molecular Formula: | C16 H9 Br F6 N6 S |
| CAS Number: | 956014-19-0 |
| Smiles: | c1cc(c(cc1[Br])c1nnn[nH]1)NC(Nc1cc(cc(c1)C(F)(F)F)C(F)(F)F)=S |
| InChI Key: | MDKAFDIKYQMOMF-UHFFFAOYSA-N |
| Short Description: | NS 11021 (NS11021) , a novel opener of large-conductance Ca(2+)-activated K(+) channels |
| Pathway: | Membrane transporter/Ion channel |
| Target: | Potassium Channel |
| Alias: | NS11021 |
| Stock amount: | 935 |