PFI-2 hydrochloride
Chemical Structure Depiction of
PFI-2 hydrochloride
PFI-2 hydrochloride
Compound characteristics
| Compound ID: | CE04-5637 |
| Compound Name: | PFI-2 hydrochloride |
| Molecular Weight: | 535.99 |
| Molecular Formula: | C23 H25 F4 N3 O3 S.H Cl |
| CAS Number: | 1627607-87-7 |
| Smiles: | C1CCN(C1)C([C@@H](Cc1cccc(c1)C(F)(F)F)NS(c1cc2CCNCc2c(c1)F)(=O)=O)=O.[Cl] |
| InChI Key: | ZADKZNVAJGEFLC-ZMBIFBSDSA-N |
| Short Description: | PFI-2 hydrochloride ((R)-PFI-2 hydrochloride) is a potent, highly selective, and cell-active inhibitor of the methyltransferase activity of SETD7 (IC50: 2 nM), 500 fold active than (S)-PFI-2. |
| Pathway: | Chromatin/Epigenetic |
| Target: | Histone Methyltransferase |
| Alias: | (R)-PFI-2 hydrochloride , PFI-2 HCl |
| Stock amount: | 2081 |