1-pentyl-1H-indole-3-carboxylic acid
Chemical Structure Depiction of
1-pentyl-1H-indole-3-carboxylic acid
1-pentyl-1H-indole-3-carboxylic acid
Compound characteristics
| Compound ID: | CE04-6181 |
| Compound Name: | 1-pentyl-1H-indole-3-carboxylic acid |
| Molecular Weight: | 231.29 |
| Molecular Formula: | C14 H17 N O2 |
| CAS Number: | 727421-73-0 |
| Smiles: | CCCCCn1cc(C(O)=O)c2ccccc12 |
| InChI Key: | HAPJUNILBCTRIJ-UHFFFAOYSA-N |
| Short Description: | 1-pentyl-1H-indole-3-carboxylic acid is a naturally occurring indole alkaloid. It has a variety of biological activities, including anti-inflammatory, analgesic, antioxidant and antifungal, and antitu mor activity. It acts by binding to various receptors and enzymes in the body, including serotonin receptors, cannabinoid receptors, PPARgamma receptors and PDE4 enzymes. |
| Pathway: | Others |
| Target: | Others |
| Stock amount: | 996 |