Tofogliflozin (hydrate)
Chemical Structure Depiction of
Tofogliflozin (hydrate)
Tofogliflozin (hydrate)
Compound characteristics
| Compound ID: | CE04-6231 |
| Compound Name: | Tofogliflozin (hydrate) |
| Molecular Weight: | 404.46 |
| Molecular Formula: | C22 H26 O6.H2 O |
| CAS Number: | 1201913-82-7 |
| Smiles: | CCc1ccc(Cc2ccc3CO[C@]4(c3c2)[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)cc1.O |
| InChI Key: | ZXOCGDDVNPDRIW-OWVGPGEUSA-N |
| Short Description: | Tofogliflozin hydrate (CSG-452 hydrate) is a potent and highly specific inhibitor of SGLT2(IC50 of 2.9 nM and Ki values of 2.9 nM, 14.9 nM, and 6.4 nM for human, rat, and mouse SGLT2). |
| Pathway: | NF-Kappab|||Immunology/Inflammation|||GPCR/G Protein|||Metabolism |
| Target: | SGLT|||ROS|||Reactive Oxygen Species |
| Type of molecule: | Approved/Clinical |
| Alias: | Tofogliflozin hydrate , CSG-452 hydrate |
| Stock amount: | 2303 |