Ralimetinib dimesylate
Chemical Structure Depiction of
Ralimetinib dimesylate
Ralimetinib dimesylate
Compound characteristics
| Compound ID: | CE04-7593 |
| Compound Name: | Ralimetinib dimesylate |
| Molecular Weight: | 612.74 |
| Molecular Formula: | C24 H29 F N6.C H4 O3 S.C H4 O3 S |
| CAS Number: | 862507-23-1 |
| Smiles: | CC(C)(C)Cn1c(N)nc2ccc(c3c(c4ccc(cc4)F)nc(C(C)(C)C)[nH]3)nc12.CS(O)(=O)=O.CS(O)(=O)=O |
| InChI Key: | NARMJPIBAXVUIE-UHFFFAOYSA-N |
| Short Description: | Ralimetinib dimesylate (LY2228820 dimesylate) is the dimesylate salt form of LY2228820, a tri-substituted imidazole derivative and orally available, p38 mitogen-activated protein kinase (MAPK) inhibit or with potential anti-inflammatory and antineoplastic activities. |
| Pathway: | Autophagy|||MAPK|||Apoptosis |
| Target: | Autophagy|||Apoptosis|||p38 MAPK |
| Type of molecule: | Clinical |
| Alias: | LY2228820 , Ralimetinib , Ralimetinib Mesylate , LY2228820 dimesylate |
| Stock amount: | 541 |