Turofexorate Isopropyl
Chemical Structure Depiction of
Turofexorate Isopropyl
Turofexorate Isopropyl
Compound characteristics
| Compound ID: | CE04-7642 |
| Compound Name: | Turofexorate Isopropyl |
| Molecular Weight: | 438.47 |
| Molecular Formula: | C25 H24 F2 N2 O3 |
| CAS Number: | 629664-81-9 |
| Smiles: | CC(C)OC(C1=CN(CC(C)(C)c2c3ccccc3[nH]c12)C(c1ccc(c(c1)F)F)=O)=O |
| InChI Key: | INASOKQDNHHMRE-UHFFFAOYSA-N |
| Short Description: | Turofexorate Isopropyl (XL335) is a potent, selective, and orally bioavailable FXR agonist with EC50 of 4 nM |
| Pathway: | Autophagy|||Metabolism |
| Target: | Autophagy|||FXR |
| Type of molecule: | Clinical |
| Alias: | XL335 , WAY-362450 , FXR-450 |
| Stock amount: | 683 |