OPC-14523 hydrochloride
Chemical Structure Depiction of
OPC-14523 hydrochloride
OPC-14523 hydrochloride
Compound characteristics
| Compound ID: | CE04-9481 |
| Compound Name: | OPC-14523 hydrochloride |
| Molecular Weight: | 450.41 |
| Molecular Formula: | C23 H28 Cl N3 O2.H Cl |
| CAS Number: | 145969-31-9 |
| Smiles: | COc1cccc2c1CCC(N2CCCN1CCN(CC1)c1cccc(c1)[Cl])=O.[Cl] |
| InChI Key: | SFOVXVXPFWJNBL-UHFFFAOYSA-N |
| Short Description: | OPC-14523 hydrochloride is an orally active sigma and 5-HT1A receptor agonist with antidepressant-like activity. OPC-14523 shows a high affinity for the sigma receptor sigma1/2 (IC50=47/56 nM), the 5- HT1A receptor (IC50=2.3 nM) and the 5-HT transporter (IC50=80 nM). |
| Stock amount: | 100 |