AEBSF hydrochloride
Chemical Structure Depiction of
AEBSF hydrochloride
AEBSF hydrochloride
Compound characteristics
| Compound ID: | CE05-0278 |
| Compound Name: | AEBSF hydrochloride |
| Molecular Weight: | 239.69 |
| Molecular Formula: | C8 H10 F N O2 S.H Cl |
| CAS Number: | 30827-99-7 |
| Smiles: | C(CN)c1ccc(cc1)S(=O)(=O)F.[Cl] |
| InChI Key: | WRDABNWSWOHGMS-UHFFFAOYSA-N |
| Short Description: | AEBSF hydrochloride (Pefabloc SC) is an irreversible inhibitor of serine proteases, such as chymotrypsin, kallikrein, thrombin, plasmin, and trypsin. |
| Pathway: | Microbiology/Virology|||Proteases/Proteasome |
| Target: | Thrombin|||Serine Protease|||Influenza Virus |
| Alias: | AEBSF HCl , Pefabloc SC |
| Stock amount: | 80595 |