Cilazapril Monohydrate
Chemical Structure Depiction of
Cilazapril Monohydrate
Cilazapril Monohydrate
Compound characteristics
| Compound ID: | CE05-0784 |
| Compound Name: | Cilazapril Monohydrate |
| Molecular Weight: | 435.52 |
| Molecular Formula: | C22 H31 N3 O5.H2 O |
| CAS Number: | 92077-78-6 |
| Smiles: | CCOC([C@H](CCc1ccccc1)N[C@H]1CCCN2CCC[C@@H](C(O)=O)N2C1=O)=O.O |
| InChI Key: | JQRZBPFGBRIWSN-YOTVLOEGSA-N |
| Short Description: | Cilazapril Monohydrate (Justor) is an angiotensin-converting enzyme (ACE) inhibitor used for the treatment of hypertension and congestive heart failure. |
| Pathway: | Endocrinology/Hormones |
| Target: | RAAS |
| Type of molecule: | FDA Approved |
| Alias: | Justor , Ro 31-2848 monohydrate |
| Stock amount: | 100 |