CGP 55845
Chemical Structure Depiction of
CGP 55845
CGP 55845
Compound characteristics
| Compound ID: | CE05-4099 |
| Compound Name: | CGP 55845 |
| Molecular Weight: | 402.26 |
| Molecular Formula: | C18 H22 Cl2 N O3 P |
| CAS Number: | 150175-54-5 |
| Smiles: | C[C@@H](c1ccc(c(c1)[Cl])[Cl])NC[C@@H](CP(Cc1ccccc1)(O)=O)O |
| InChI Key: | ZODSPDOOCZZEIM-BBRMVZONSA-N |
| Short Description: | CGP 55845 is a potent, selective GABAB receptor antagonist (IC50 = 5 nM) that prevents agonist binding (pKi = 8.35) and inhibits GABA and glutamate release (pEC50 values are 8.08 and 7.85 respectively ). |
| Stock amount: | 100 |