Amonafide dihydrochloride
Chemical Structure Depiction of
Amonafide dihydrochloride
Amonafide dihydrochloride
Compound characteristics
| Compound ID: | CE05-4101 |
| Compound Name: | Amonafide dihydrochloride |
| Molecular Weight: | 356.25 |
| Molecular Formula: | C16 H17 N3 O2.H Cl.H Cl |
| CAS Number: | 150091-68-2 |
| Smiles: | CN(C)CCN1C(c2cccc3cc(cc(C1=O)c23)N)=O.[Cl].[Cl] |
| InChI Key: | AEMLYYQEBPJIEO-UHFFFAOYSA-N |
| Short Description: | Amonafide dihydrochloride is the dihydrochloride salt of amonafide, an imide derivative of naphthalic acid. Amonafide intercalates into DNA and inhibits topoisomerase II, resulting in protein-associat ed strand breaks and impaired DNA and RNA synthesis. |
| Stock amount: | 100 |