Benastatin B
Chemical Structure Depiction of
Benastatin B
Benastatin B
Compound characteristics
| Compound ID: | CE05-4380 |
| Compound Name: | Benastatin B |
| Molecular Weight: | 502.56 |
| Molecular Formula: | C30 H30 O7 |
| CAS Number: | 138968-86-2 |
| Smiles: | CCCCCc1cc2CCc3c(cc4c(C(c5c(cc(cc5O)O)C4(C)C)=O)c3O)c2c(c1C(O)=O)O |
| InChI Key: | FUKMCLKFEWEFSC-UHFFFAOYSA-N |
| Short Description: | Benastatin B is a polyketide synthase-derived benastatin that has been found in Streptomyces and has diverse biological activities. It inhibits glutathione S-transferase (GST; Ki = 3.7 uM for the rat liver enzyme).2 Benastatin B also inhibits the transglycosylase activity of A. baumannii, C. difficile, E. coli, and S. aureus recombinant penicillin-binding proteins (PBPs; IC50s = 16, 53.3, 30.7, an d 31.6 uM, respectively).3 It is active against several bacteria, including methicillin-resistant S. aureus (MRSA; MIC = 3.12 ug/ml). |
| Stock amount: | 100 |