Caramiphen hydrochloride
Chemical Structure Depiction of
Caramiphen hydrochloride
Caramiphen hydrochloride
Compound characteristics
| Compound ID: | CE05-4697 |
| Compound Name: | Caramiphen hydrochloride |
| Molecular Weight: | 325.88 |
| Molecular Formula: | C18 H27 N O2.H Cl |
| CAS Number: | 125-85-9 |
| Smiles: | CCN(CC)CCOC(C1(CCCC1)c1ccccc1)=O.[Cl] |
| InChI Key: | MUPNXGNOIBYHSG-UHFFFAOYSA-N |
| Short Description: | Caramiphen hydrochloride is the salt form of Caramiphne (free base), which is an antimuscarinic and anticholinergic agent. It acts as an antagonist of NMDA receptor. |
| Stock amount: | 100 |