Famotidine sulfamoyl propanamide
Chemical Structure Depiction of
Famotidine sulfamoyl propanamide
Famotidine sulfamoyl propanamide
Compound characteristics
| Compound ID: | CE05-5048 |
| Compound Name: | Famotidine sulfamoyl propanamide |
| Molecular Weight: | 338.43 |
| Molecular Formula: | C8 H14 N6 O3 S3 |
| CAS Number: | 106433-44-7 |
| Smiles: | C(CSCc1csc(NC(N)=N)n1)C(NS(N)(=O)=O)=O |
| InChI Key: | BPCROVNHEMFQOD-UHFFFAOYSA-N |
| Short Description: | Famotidine sulfamoyl propanamide is a histamine H2-receptor antagonist that inhibits stomach acid production. It is commonly used in the treatment of peptic ulcer disease and gastroesophageal reflux d isease. |
| Stock amount: | 100 |