Estrone O-sulfamate
Chemical Structure Depiction of
Estrone O-sulfamate
Estrone O-sulfamate
Compound characteristics
| Compound ID: | CE05-5845 |
| Compound Name: | Estrone O-sulfamate |
| Molecular Weight: | 349.45 |
| Molecular Formula: | C18 H23 N O4 S |
| CAS Number: | 148672-09-7 |
| Smiles: | [H][C@@]12CC[C@]3(C)C(CC[C@@]3([H])[C@]2([H])CCc2cc(ccc12)OS(N)(=O)=O)=O |
| InChI Key: | RVKFQAJIXCZXQY-CVYDXHPNSA-N |
| Short Description: | Estrone O-sulfamate (Estrone 3-O-sulfamate) is a potent inhibitor of steroid sulfatase (STS). Estrone O-sulfamate is a placental microsomal inhibitor (P.M.) with IC50 values of 18 nM. Estrone O-sulfam ate showed inhibitory effects on STS in MCF-7 cells with IC50 values of 0.83 nM. Estrone O-sulfamate can be used to study cancer. |
| Pathway: | Others |
| Target: | Others |
| Alias: | Estrone 3-O-sulfamate |
| Stock amount: | 503 |